C33H24ClNO4S — CID 59335612
3-[4-[(4-chlorophenyl)methoxy]phenyl]-2-[[5-(2-phenylethynyl)-1-benzothiophene-2-carbonyl]amino]propanoic acid (PubChem CID 59335612) has the molecular formula C33H24ClNO4S and a molecular weight of 566.08 g/mol. Its IUPAC name is 3-[4-[(4-chlorophenyl)methoxy]phenyl]-2-[[5-(2-phenylethynyl)-1-benzothiophene-2-carbonyl]amino]propanoic acid.
| Compound Name | 3-[4-[(4-chlorophenyl)methoxy]phenyl]-2-[[5-(2-phenylethynyl)-1-benzothiophene-2-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 59335612 |
| Molecular Formula | C33H24ClNO4S |
| Molecular Weight | 566.08 g/mol |
| Exact Mass | 565.11 |
| IUPAC Name | 3-[4-[(4-chlorophenyl)methoxy]phenyl]-2-[[5-(2-phenylethynyl)-1-benzothiophene-2-carbonyl]amino]propanoic acid |
| SMILES | O=C(NC(Cc1ccc(OCc2ccc(Cl)cc2)cc1)C(=O)O)c1cc2cc(C#Cc3ccccc3)ccc2s1 |
| InChI | InChI=1S/C33H24ClNO4S/c34-27-13-8-25(9-14-27)21-39-28-15-10-24(11-16-28)19-29(33(37)38)35-32(36)31-20-26-18-23(12-17-30(26)40-31)7-6-22-4-2-1-3-5-22/h1-5,8-18,20,29H,19,21H2,(H,35,36)(H,37,38) |
| InChIKey | LARWPBBXGPQVOA-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.08 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|