C20H25Cl2N3OS — CID 59338739
2-(2,3-dichlorophenyl)-4-methyl-N-[3-(2-methylpiperidin-1-yl)propyl]-1,3-thiazole-5-carboxamide (PubChem CID 59338739) has the molecular formula C20H25Cl2N3OS and a molecular weight of 426.41 g/mol. Its IUPAC name is 2-(2,3-dichlorophenyl)-4-methyl-N-[3-(2-methylpiperidin-1-yl)propyl]-1,3-thiazole-5-carboxamide.
| Compound Name | 2-(2,3-dichlorophenyl)-4-methyl-N-[3-(2-methylpiperidin-1-yl)propyl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 59338739 |
| Molecular Formula | C20H25Cl2N3OS |
| Molecular Weight | 426.41 g/mol |
| Exact Mass | 425.11 |
| IUPAC Name | 2-(2,3-dichlorophenyl)-4-methyl-N-[3-(2-methylpiperidin-1-yl)propyl]-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(-c2cccc(Cl)c2Cl)sc1C(=O)NCCCN1CCCCC1C |
| InChI | InChI=1S/C20H25Cl2N3OS/c1-13-7-3-4-11-25(13)12-6-10-23-19(26)18-14(2)24-20(27-18)15-8-5-9-16(21)17(15)22/h5,8-9,13H,3-4,6-7,10-12H2,1-2H3,(H,23,26) |
| InChIKey | FHXKFYGGXRAHTG-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.41 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|