C33H28F6N2O4 — CID 59344377
2-[4-[[4-[1,1,1,3,3,3-hexafluoro-2-[4-[[4-(2-hydroxyethoxy)phenyl]methylideneamino]phenyl]propan-2-yl]phenyl]iminomethyl]phenoxy]ethanol (PubChem CID 59344377) has the molecular formula C33H28F6N2O4 and a molecular weight of 630.58 g/mol. Its IUPAC name is 2-[4-[[4-[1,1,1,3,3,3-hexafluoro-2-[4-[[4-(2-hydroxyethoxy)phenyl]methylideneamino]phenyl]propan-2-yl]phenyl]iminomethyl]phenoxy]ethanol.
| Compound Name | 2-[4-[[4-[1,1,1,3,3,3-hexafluoro-2-[4-[[4-(2-hydroxyethoxy)phenyl]methylideneamino]phenyl]propan-2-yl]phenyl]iminomethyl]phenoxy]ethanol |
|---|---|
| PubChem CID | 59344377 |
| Molecular Formula | C33H28F6N2O4 |
| Molecular Weight | 630.58 g/mol |
| Exact Mass | 630.20 |
| IUPAC Name | 2-[4-[[4-[1,1,1,3,3,3-hexafluoro-2-[4-[[4-(2-hydroxyethoxy)phenyl]methylideneamino]phenyl]propan-2-yl]phenyl]iminomethyl]phenoxy]ethanol |
| SMILES | OCCOc1ccc(/C=N/c2ccc(C(c3ccc(/N=C/c4ccc(OCCO)cc4)cc3)(C(F)(F)F)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C33H28F6N2O4/c34-32(35,36)31(33(37,38)39,25-5-9-27(10-6-25)40-21-23-1-13-29(14-2-23)44-19-17-42)26-7-11-28(12-8-26)41-22-24-3-15-30(16-4-24)45-20-18-43/h1-16,21-22,42-43H,17-20H2/b40-21+,41-22+ |
| InChIKey | IKVDNSBKFMWBCB-QHGYPJACSA-N |
| XLogP | 7.34 |
| TPSA | 83.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.58 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|