C25H33N3O6 — CID 59347249
[1-[6-(1,3-dioxoisoindol-2-yl)hexanoyl]-4-ethylpyrrolidin-3-yl] 4-(methylamino)-4-oxobutanoate (PubChem CID 59347249) has the molecular formula C25H33N3O6 and a molecular weight of 471.55 g/mol. Its IUPAC name is [1-[6-(1,3-dioxoisoindol-2-yl)hexanoyl]-4-ethylpyrrolidin-3-yl] 4-(methylamino)-4-oxobutanoate.
| Compound Name | [1-[6-(1,3-dioxoisoindol-2-yl)hexanoyl]-4-ethylpyrrolidin-3-yl] 4-(methylamino)-4-oxobutanoate |
|---|---|
| PubChem CID | 59347249 |
| Molecular Formula | C25H33N3O6 |
| Molecular Weight | 471.55 g/mol |
| Exact Mass | 471.24 |
| IUPAC Name | [1-[6-(1,3-dioxoisoindol-2-yl)hexanoyl]-4-ethylpyrrolidin-3-yl] 4-(methylamino)-4-oxobutanoate |
| SMILES | CCC1CN(C(=O)CCCCCN2C(=O)c3ccccc3C2=O)CC1OC(=O)CCC(=O)NC |
| InChI | InChI=1S/C25H33N3O6/c1-3-17-15-27(16-20(17)34-23(31)13-12-21(29)26-2)22(30)11-5-4-8-14-28-24(32)18-9-6-7-10-19(18)25(28)33/h6-7,9-10,17,20H,3-5,8,11-16H2,1-2H3,(H,26,29) |
| InChIKey | BGJJCJQKXZYIMQ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.55 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|