C44H76N2O6 — CID 59347255
2-[[(2R)-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-yl]oxy]ethyl N-[6-[(2R,4R)-2-ethyl-4-hydroxypyrrolidin-1-yl]-6-oxohexyl]carbamate (PubChem CID 59347255) has the molecular formula C44H76N2O6 and a molecular weight of 729.10 g/mol. Its IUPAC name is 2-[[(2R)-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-yl]oxy]ethyl N-[6-[(2R,4R)-2-ethyl-4-hydroxypyrrolidin-1-yl]-6-oxohexyl]carbamate.
| Compound Name | 2-[[(2R)-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-yl]oxy]ethyl N-[6-[(2R,4R)-2-ethyl-4-hydroxypyrrolidin-1-yl]-6-oxohexyl]carbamate |
|---|---|
| PubChem CID | 59347255 |
| Molecular Formula | C44H76N2O6 |
| Molecular Weight | 729.10 g/mol |
| Exact Mass | 728.57 |
| IUPAC Name | 2-[[(2R)-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-yl]oxy]ethyl N-[6-[(2R,4R)-2-ethyl-4-hydroxypyrrolidin-1-yl]-6-oxohexyl]carbamate |
| SMILES | CC[C@@H]1C[C@@H](O)CN1C(=O)CCCCCNC(=O)OCCOc1c(C)c(C)c2c(c1C)CC[C@@](C)(CCC[C@H](C)CCC[C@H](C)CCCC(C)C)O2 |
| InChI | InChI=1S/C44H76N2O6/c1-10-37-29-38(47)30-46(37)40(48)22-12-11-13-26-45-43(49)51-28-27-50-41-34(6)35(7)42-39(36(41)8)23-25-44(9,52-42)24-16-21-33(5)20-15-19-32(4)18-14-17-31(2)3/h31-33,37-38,47H,10-30H2,1-9H3,(H,45,49)/t32-,33-,37-,38-,44-/m1/s1 |
| InChIKey | CANPYHUCEJVJGU-UCQJDMJOSA-N |
| XLogP | 10.17 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.10 |
| LogP ≤ 5 | 10.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|