C79H53N6O4PtS2-3 — CID 59359335
CID 59359335 (PubChem CID 59359335) has the molecular formula C79H53N6O4PtS2-3 and a molecular weight of 1409.54 g/mol.
| Compound Name | CID 59359335 |
|---|---|
| PubChem CID | 59359335 |
| Molecular Formula | C79H53N6O4PtS2-3 |
| Molecular Weight | 1409.54 g/mol |
| Exact Mass | 1408.32 |
| IUPAC Name | — |
| SMILES | CCC(COc1ccc2c(c1)c1ccccc1n2-c1ccc2oc3ccc(-c4cc5c6ccc[c-]c6n6nccc6c5s4)cc3c2c1)OC.[Pt].[c-]1cccc2c1N1[N-]CCC1c1sc(-c3ccc4oc5ccc(-n6c7ccccc7c7ccccc76)cc5c4c3)cc1-2 |
| InChI | InChI=1S/C42H30N3O3S.C37H23N3OS.Pt/c1-3-27(46-2)24-47-28-14-15-36-31(22-28)29-8-4-6-10-35(29)44(36)26-13-17-40-33(21-26)32-20-25(12-16-39(32)48-40)41-23-34-30-9-5-7-11-37(30)45-38(18-19-43-45)42(34)49-41;1-4-10-30-24(7-1)25-8-2-5-11-31(25)39(30)23-14-16-35-28(20-23)27-19-22(13-15-34(27)41-35)36-21-29-26-9-3-6-12-32(26)40-33(17-18-38-40)37(29)42-36;/h4-10,12-23,27H,3,24H2,1-2H3;1-11,13-16,19-21,33H,17-18H2;/q-1;-2; |
| InChIKey | PVDXBLCFMFZNCJ-UHFFFAOYSA-N |
| XLogP | 21.40 |
| TPSA | 89.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 92 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1409.54 |
| LogP ≤ 5 | 21.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|