C34H31N3O5 — CID 59362317
9H-fluoren-9-ylmethyl N-[2-[[1-(1H-indol-3-yl)-2-phenylmethoxyethyl]amino]-2-oxoethoxy]carbamate (PubChem CID 59362317) has the molecular formula C34H31N3O5 and a molecular weight of 561.64 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[2-[[1-(1H-indol-3-yl)-2-phenylmethoxyethyl]amino]-2-oxoethoxy]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[2-[[1-(1H-indol-3-yl)-2-phenylmethoxyethyl]amino]-2-oxoethoxy]carbamate |
|---|---|
| PubChem CID | 59362317 |
| Molecular Formula | C34H31N3O5 |
| Molecular Weight | 561.64 g/mol |
| Exact Mass | 561.23 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[2-[[1-(1H-indol-3-yl)-2-phenylmethoxyethyl]amino]-2-oxoethoxy]carbamate |
| SMILES | O=C(CONC(=O)OCC1c2ccccc2-c2ccccc21)NC(COCc1ccccc1)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C34H31N3O5/c38-33(22-42-37-34(39)41-20-30-26-14-6-4-12-24(26)25-13-5-7-15-27(25)30)36-32(21-40-19-23-10-2-1-3-11-23)29-18-35-31-17-9-8-16-28(29)31/h1-18,30,32,35H,19-22H2,(H,36,38)(H,37,39) |
| InChIKey | QGIYLJXADWFUFK-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 101.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.64 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|