C23H16Cl4N4O — CID 59363153
4,5-bis(2,4-dichlorophenyl)-N-(2-phenylethyl)triazole-2-carboxamide (PubChem CID 59363153) has the molecular formula C23H16Cl4N4O and a molecular weight of 506.22 g/mol. Its IUPAC name is 4,5-bis(2,4-dichlorophenyl)-N-(2-phenylethyl)triazole-2-carboxamide.
| Compound Name | 4,5-bis(2,4-dichlorophenyl)-N-(2-phenylethyl)triazole-2-carboxamide |
|---|---|
| PubChem CID | 59363153 |
| Molecular Formula | C23H16Cl4N4O |
| Molecular Weight | 506.22 g/mol |
| Exact Mass | 504.01 |
| IUPAC Name | 4,5-bis(2,4-dichlorophenyl)-N-(2-phenylethyl)triazole-2-carboxamide |
| SMILES | O=C(NCCc1ccccc1)n1nc(-c2ccc(Cl)cc2Cl)c(-c2ccc(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C23H16Cl4N4O/c24-15-6-8-17(19(26)12-15)21-22(18-9-7-16(25)13-20(18)27)30-31(29-21)23(32)28-11-10-14-4-2-1-3-5-14/h1-9,12-13H,10-11H2,(H,28,32) |
| InChIKey | ATLGDWCKDFZFGF-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.22 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |