About 2-diazenylpropan-1-ol
2-diazenylpropan-1-ol (PubChem CID 59364551) has the molecular formula C3H8N2O
and a molecular weight of 88.11 g/mol. Its IUPAC name is 2-diazenylpropan-1-ol.
Molecular Properties
| Compound Name | 2-diazenylpropan-1-ol |
| PubChem CID | 59364551 |
| Molecular Formula | C3H8N2O |
| Molecular Weight | 88.11 g/mol |
| Exact Mass | 88.06 |
| IUPAC Name | 2-diazenylpropan-1-ol |
| SMILES | [H]/N=N/C(C)CO |
| InChI | InChI=1S/C3H8N2O/c1-3(2-6)5-4/h3-4,6H,2H2,1H3/b5-4+ |
| InChIKey | OQJWIMLFXBALQW-SNAWJCMRSA-N |
| XLogP | 0.40 |
| TPSA | 56.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 88.11 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-diazenylpropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-diazenylpropan-1-ol?
The IUPAC name of 2-diazenylpropan-1-ol (CID 59364551) is 2-diazenylpropan-1-ol.
What is the SMILES notation for 2-diazenylpropan-1-ol?
The canonical SMILES for 2-diazenylpropan-1-ol is [H]/N=N/C(C)CO.
What is the InChIKey of 2-diazenylpropan-1-ol?
The InChIKey is OQJWIMLFXBALQW-SNAWJCMRSA-N. The full InChI is InChI=1S/C3H8N2O/c1-3(2-6)5-4/h3-4,6H,2H2,1H3/b5-4+.
What are the key properties of 2-diazenylpropan-1-ol?
2-diazenylpropan-1-ol has a molecular weight of 88.11 g/mol, XLogP of 0.40, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-diazenylpropan-1-ol is sourced from PubChem (CID 59364551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).