C5H13N3O — CID 89325798
(2S,3S)-3-(aminodiazenyl)pentan-2-ol (PubChem CID 89325798) has the molecular formula C5H13N3O and a molecular weight of 131.18 g/mol. Its IUPAC name is (2S,3S)-3-(aminodiazenyl)pentan-2-ol.
| Compound Name | (2S,3S)-3-(aminodiazenyl)pentan-2-ol |
|---|---|
| PubChem CID | 89325798 |
| Molecular Formula | C5H13N3O |
| Molecular Weight | 131.18 g/mol |
| Exact Mass | 131.11 |
| IUPAC Name | (2S,3S)-3-(aminodiazenyl)pentan-2-ol |
| SMILES | CC[C@H](/N=N/N)[C@H](C)O |
| InChI | InChI=1S/C5H13N3O/c1-3-5(4(2)9)7-8-6/h4-5,9H,3H2,1-2H3,(H2,6,7)/t4-,5-/m0/s1 |
| InChIKey | VLIMIOGFXLOTSL-WHFBIAKZSA-N |
| XLogP | 0.47 |
| TPSA | 70.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 131.18 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|