C16H14N2S2 — CID 59365276
2-(thiophen-2-ylmethyl)-4,9-dihydro-3H-pyrido[3,4-b]indole-1-thione (PubChem CID 59365276) has the molecular formula C16H14N2S2 and a molecular weight of 298.44 g/mol. Its IUPAC name is 2-(thiophen-2-ylmethyl)-4,9-dihydro-3H-pyrido[3,4-b]indole-1-thione.
| Compound Name | 2-(thiophen-2-ylmethyl)-4,9-dihydro-3H-pyrido[3,4-b]indole-1-thione |
|---|---|
| PubChem CID | 59365276 |
| Molecular Formula | C16H14N2S2 |
| Molecular Weight | 298.44 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | 2-(thiophen-2-ylmethyl)-4,9-dihydro-3H-pyrido[3,4-b]indole-1-thione |
| SMILES | S=C1c2[nH]c3ccccc3c2CCN1Cc1cccs1 |
| InChI | InChI=1S/C16H14N2S2/c19-16-15-13(12-5-1-2-6-14(12)17-15)7-8-18(16)10-11-4-3-9-20-11/h1-6,9,17H,7-8,10H2 |
| InChIKey | RXZMCORNZWWTLG-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.44 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|