C24H34 — CID 59372846
(3Z,6S,7E,14E,16S,18Z)-6,16-dimethyldocosa-3,7,14,18-tetraen-9,12-diyne (PubChem CID 59372846) has the molecular formula C24H34 and a molecular weight of 322.54 g/mol. Its IUPAC name is (3Z,6S,7E,14E,16S,18Z)-6,16-dimethyldocosa-3,7,14,18-tetraen-9,12-diyne.
| Compound Name | (3Z,6S,7E,14E,16S,18Z)-6,16-dimethyldocosa-3,7,14,18-tetraen-9,12-diyne |
|---|---|
| PubChem CID | 59372846 |
| Molecular Formula | C24H34 |
| Molecular Weight | 322.54 g/mol |
| Exact Mass | 322.27 |
| IUPAC Name | (3Z,6S,7E,14E,16S,18Z)-6,16-dimethyldocosa-3,7,14,18-tetraen-9,12-diyne |
| SMILES | CC/C=C\C[C@H](C)/C=C/C#CCC#C/C=C/[C@@H](C)C/C=C\CCC |
| InChI | InChI=1S/C24H34/c1-5-7-9-16-20-24(4)22-18-14-12-10-11-13-17-21-23(3)19-15-8-6-2/h8-9,15-18,21-24H,5-7,10,19-20H2,1-4H3/b15-8-,16-9-,21-17+,22-18+/t23-,24-/m0/s1 |
| InChIKey | DMICGESJRUNKFZ-WBERSPHTSA-N |
| XLogP | 6.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.54 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|