C11H12N2O2 — CID 59373185
(2S)-2-amino-3-(2-deuterio-1H-indol-3-yl)propanoic acid (PubChem CID 59373185) has the molecular formula C11H12N2O2 and a molecular weight of 205.24 g/mol. Its IUPAC name is (2S)-2-amino-3-(2-deuterio-1H-indol-3-yl)propanoic acid.
| Compound Name | (2S)-2-amino-3-(2-deuterio-1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 59373185 |
| Molecular Formula | C11H12N2O2 |
| Molecular Weight | 205.24 g/mol |
| Exact Mass | 205.10 |
| IUPAC Name | (2S)-2-amino-3-(2-deuterio-1H-indol-3-yl)propanoic acid |
| SMILES | [2H]c1[nH]c2ccccc2c1C[C@H](N)C(=O)O |
| InChI | InChI=1S/C11H12N2O2/c12-9(11(14)15)5-7-6-13-10-4-2-1-3-8(7)10/h1-4,6,9,13H,5,12H2,(H,14,15)/t9-/m0/s1/i6D |
| InChIKey | QIVBCDIJIAJPQS-JNRDTBKQSA-N |
| XLogP | 1.12 |
| TPSA | 79.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.24 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |