C17H16ClFN4OS — CID 59374724
N-[5-(2-amino-4-methyl-5,6-dihydro-1,3-thiazin-4-yl)-2-fluorophenyl]-6-chloropyridine-2-carboxamide (PubChem CID 59374724) has the molecular formula C17H16ClFN4OS and a molecular weight of 378.86 g/mol. Its IUPAC name is N-[5-(2-amino-4-methyl-5,6-dihydro-1,3-thiazin-4-yl)-2-fluorophenyl]-6-chloropyridine-2-carboxamide.
| Compound Name | N-[5-(2-amino-4-methyl-5,6-dihydro-1,3-thiazin-4-yl)-2-fluorophenyl]-6-chloropyridine-2-carboxamide |
|---|---|
| PubChem CID | 59374724 |
| Molecular Formula | C17H16ClFN4OS |
| Molecular Weight | 378.86 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | N-[5-(2-amino-4-methyl-5,6-dihydro-1,3-thiazin-4-yl)-2-fluorophenyl]-6-chloropyridine-2-carboxamide |
| SMILES | CC1(c2ccc(F)c(NC(=O)c3cccc(Cl)n3)c2)CCSC(N)=N1 |
| InChI | InChI=1S/C17H16ClFN4OS/c1-17(7-8-25-16(20)23-17)10-5-6-11(19)13(9-10)22-15(24)12-3-2-4-14(18)21-12/h2-6,9H,7-8H2,1H3,(H2,20,23)(H,22,24) |
| InChIKey | SCODAEKVPYUBMC-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 80.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.86 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|