About 1-(1-pyrrolidin-1-yl-3-tricyclo[3.3.1.03,7]nonanyl)ethanone
1-(1-pyrrolidin-1-yl-3-tricyclo[3.3.1.03,7]nonanyl)ethanone (PubChem CID 59374976) has the molecular formula C15H23NO
and a molecular weight of 233.35 g/mol. Its IUPAC name is 1-(1-pyrrolidin-1-yl-3-tricyclo[3.3.1.03,7]nonanyl)ethanone.
Analyze 1-(1-pyrrolidin-1-yl-3-tricyclo[3.3.1.03,7]nonanyl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-pyrrolidin-1-yl-3-tricyclo[3.3.1.03,7]nonanyl)ethanone?
The IUPAC name of 1-(1-pyrrolidin-1-yl-3-tricyclo[3.3.1.03,7]nonanyl)ethanone (CID 59374976) is 1-(1-pyrrolidin-1-yl-3-tricyclo[3.3.1.03,7]nonanyl)ethanone.
What is the SMILES notation for 1-(1-pyrrolidin-1-yl-3-tricyclo[3.3.1.03,7]nonanyl)ethanone?
The canonical SMILES for 1-(1-pyrrolidin-1-yl-3-tricyclo[3.3.1.03,7]nonanyl)ethanone is CC(=O)C12CC3CC1CC(N1CCCC1)(C3)C2.
What is the InChIKey of 1-(1-pyrrolidin-1-yl-3-tricyclo[3.3.1.03,7]nonanyl)ethanone?
The InChIKey is WOWATGHNZYIUKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23NO/c1-11(17)15-8-12-6-13(15)9-14(7-12,10-15)16-4-2-3-5-16/h12-13H,2-10H2,1H3.
What are the key properties of 1-(1-pyrrolidin-1-yl-3-tricyclo[3.3.1.03,7]nonanyl)ethanone?
1-(1-pyrrolidin-1-yl-3-tricyclo[3.3.1.03,7]nonanyl)ethanone has a molecular weight of 233.35 g/mol, XLogP of 2.62, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-pyrrolidin-1-yl-3-tricyclo[3.3.1.03,7]nonanyl)ethanone is sourced from PubChem (CID 59374976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).