C24H26F3N3 — CID 59382174
1-[(3-pyrrol-1-ylphenyl)methyl]-4-[2-[2-(trifluoromethyl)phenyl]ethyl]piperazine (PubChem CID 59382174) has the molecular formula C24H26F3N3 and a molecular weight of 413.49 g/mol. Its IUPAC name is 1-[(3-pyrrol-1-ylphenyl)methyl]-4-[2-[2-(trifluoromethyl)phenyl]ethyl]piperazine.
| Compound Name | 1-[(3-pyrrol-1-ylphenyl)methyl]-4-[2-[2-(trifluoromethyl)phenyl]ethyl]piperazine |
|---|---|
| PubChem CID | 59382174 |
| Molecular Formula | C24H26F3N3 |
| Molecular Weight | 413.49 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | 1-[(3-pyrrol-1-ylphenyl)methyl]-4-[2-[2-(trifluoromethyl)phenyl]ethyl]piperazine |
| SMILES | FC(F)(F)c1ccccc1CCN1CCN(Cc2cccc(-n3cccc3)c2)CC1 |
| InChI | InChI=1S/C24H26F3N3/c25-24(26,27)23-9-2-1-7-21(23)10-13-28-14-16-29(17-15-28)19-20-6-5-8-22(18-20)30-11-3-4-12-30/h1-9,11-12,18H,10,13-17,19H2 |
| InChIKey | CFDNGTAISLLAHX-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 11.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.49 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |