C22H38O5 — CID 59383204
3-methyl-6-(8-oxononyl)-5-[(3-pentyloxiran-2-yl)methyl]-1,4-dioxan-2-one (PubChem CID 59383204) has the molecular formula C22H38O5 and a molecular weight of 382.54 g/mol. Its IUPAC name is 3-methyl-6-(8-oxononyl)-5-[(3-pentyloxiran-2-yl)methyl]-1,4-dioxan-2-one.
| Compound Name | 3-methyl-6-(8-oxononyl)-5-[(3-pentyloxiran-2-yl)methyl]-1,4-dioxan-2-one |
|---|---|
| PubChem CID | 59383204 |
| Molecular Formula | C22H38O5 |
| Molecular Weight | 382.54 g/mol |
| Exact Mass | 382.27 |
| IUPAC Name | 3-methyl-6-(8-oxononyl)-5-[(3-pentyloxiran-2-yl)methyl]-1,4-dioxan-2-one |
| SMILES | CCCCCC1OC1CC1OC(C)C(=O)OC1CCCCCCCC(C)=O |
| InChI | InChI=1S/C22H38O5/c1-4-5-9-13-18-21(26-18)15-20-19(27-22(24)17(3)25-20)14-11-8-6-7-10-12-16(2)23/h17-21H,4-15H2,1-3H3 |
| InChIKey | ZMJNMOOXWUPBIG-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.54 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|