C20H26 — CID 59390096
2-methyl-1-[(1S,5S)-3,6,6-trimethyl-2-bicyclo[3.1.1]hept-2-enyl]-2,3-dihydro-1H-indene (PubChem CID 59390096) has the molecular formula C20H26 and a molecular weight of 266.43 g/mol. Its IUPAC name is 2-methyl-1-[(1S,5S)-3,6,6-trimethyl-2-bicyclo[3.1.1]hept-2-enyl]-2,3-dihydro-1H-indene.
| Compound Name | 2-methyl-1-[(1S,5S)-3,6,6-trimethyl-2-bicyclo[3.1.1]hept-2-enyl]-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 59390096 |
| Molecular Formula | C20H26 |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.20 |
| IUPAC Name | 2-methyl-1-[(1S,5S)-3,6,6-trimethyl-2-bicyclo[3.1.1]hept-2-enyl]-2,3-dihydro-1H-indene |
| SMILES | CC1=C(C2c3ccccc3CC2C)[C@H]2C[C@@H](C1)C2(C)C |
| InChI | InChI=1S/C20H26/c1-12-9-14-7-5-6-8-16(14)18(12)19-13(2)10-15-11-17(19)20(15,3)4/h5-8,12,15,17-18H,9-11H2,1-4H3/t12?,15-,17-,18?/m1/s1 |
| InChIKey | GFPJNEDFSFSXRT-PELCJYOWSA-N |
| XLogP | 5.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|