C12H20N2O — CID 59395904
4-(1H-imidazol-5-ylmethyl)-2,2-dimethylhexan-3-one (PubChem CID 59395904) has the molecular formula C12H20N2O and a molecular weight of 208.31 g/mol. Its IUPAC name is 4-(1H-imidazol-5-ylmethyl)-2,2-dimethylhexan-3-one.
| Compound Name | 4-(1H-imidazol-5-ylmethyl)-2,2-dimethylhexan-3-one |
|---|---|
| PubChem CID | 59395904 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | 4-(1H-imidazol-5-ylmethyl)-2,2-dimethylhexan-3-one |
| SMILES | CCC(Cc1cnc[nH]1)C(=O)C(C)(C)C |
| InChI | InChI=1S/C12H20N2O/c1-5-9(11(15)12(2,3)4)6-10-7-13-8-14-10/h7-9H,5-6H2,1-4H3,(H,13,14) |
| InChIKey | ZJFDUZULVYEJQV-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |