About benzene;1-phenoxypropan-2-ol;yttrium
benzene;1-phenoxypropan-2-ol;yttrium (PubChem CID 59396811) has the molecular formula C15H16O2Y-2
and a molecular weight of 317.20 g/mol. Its IUPAC name is benzene;1-phenoxypropan-2-ol;yttrium.
Molecular Properties
| Compound Name | benzene;1-phenoxypropan-2-ol;yttrium |
| PubChem CID | 59396811 |
| Molecular Formula | C15H16O2Y-2 |
| Molecular Weight | 317.20 g/mol |
| Exact Mass | 317.02 |
| IUPAC Name | benzene;1-phenoxypropan-2-ol;yttrium |
| SMILES | [CH2-]C(O)COc1ccccc1.[Y].[c-]1ccccc1 |
| InChI | InChI=1S/C9H11O2.C6H5.Y/c1-8(10)7-11-9-5-3-2-4-6-9;1-2-4-6-5-3-1;/h2-6,8,10H,1,7H2;1-5H;/q2*-1; |
| InChIKey | JRKJTTUWWUHZQY-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.20 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze benzene;1-phenoxypropan-2-ol;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;1-phenoxypropan-2-ol;yttrium?
The IUPAC name of benzene;1-phenoxypropan-2-ol;yttrium (CID 59396811) is benzene;1-phenoxypropan-2-ol;yttrium.
What is the SMILES notation for benzene;1-phenoxypropan-2-ol;yttrium?
The canonical SMILES for benzene;1-phenoxypropan-2-ol;yttrium is [CH2-]C(O)COc1ccccc1.[Y].[c-]1ccccc1.
What is the InChIKey of benzene;1-phenoxypropan-2-ol;yttrium?
The InChIKey is JRKJTTUWWUHZQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11O2.C6H5.Y/c1-8(10)7-11-9-5-3-2-4-6-9;1-2-4-6-5-3-1;/h2-6,8,10H,1,7H2;1-5H;/q2*-1;.
What are the key properties of benzene;1-phenoxypropan-2-ol;yttrium?
benzene;1-phenoxypropan-2-ol;yttrium has a molecular weight of 317.20 g/mol, XLogP of 2.74, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;1-phenoxypropan-2-ol;yttrium is sourced from PubChem (CID 59396811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).