C8H9BrNO2+ — CID 59397359
4-bromo-5-hydroxy-3,4-dihydro-2H-pyrano[3,2-b]pyridin-5-ium (PubChem CID 59397359) has the molecular formula C8H9BrNO2+ and a molecular weight of 231.07 g/mol. Its IUPAC name is 4-bromo-5-hydroxy-3,4-dihydro-2H-pyrano[3,2-b]pyridin-5-ium.
| Compound Name | 4-bromo-5-hydroxy-3,4-dihydro-2H-pyrano[3,2-b]pyridin-5-ium |
|---|---|
| PubChem CID | 59397359 |
| Molecular Formula | C8H9BrNO2+ |
| Molecular Weight | 231.07 g/mol |
| Exact Mass | 229.98 |
| IUPAC Name | 4-bromo-5-hydroxy-3,4-dihydro-2H-pyrano[3,2-b]pyridin-5-ium |
| SMILES | O[n+]1cccc2c1C(Br)CCO2 |
| InChI | InChI=1S/C8H9BrNO2/c9-6-3-5-12-7-2-1-4-10(11)8(6)7/h1-2,4,6,11H,3,5H2/q+1 |
| InChIKey | SDHFOLVQRQMRIA-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 33.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.07 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|