C19H23Cl2N — CID 59401528
N,N-dibenzyl-1,5-dichloropentan-2-amine (PubChem CID 59401528) has the molecular formula C19H23Cl2N and a molecular weight of 336.31 g/mol. Its IUPAC name is N,N-dibenzyl-1,5-dichloropentan-2-amine.
| Compound Name | N,N-dibenzyl-1,5-dichloropentan-2-amine |
|---|---|
| PubChem CID | 59401528 |
| Molecular Formula | C19H23Cl2N |
| Molecular Weight | 336.31 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | N,N-dibenzyl-1,5-dichloropentan-2-amine |
| SMILES | ClCCCC(CCl)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C19H23Cl2N/c20-13-7-12-19(14-21)22(15-17-8-3-1-4-9-17)16-18-10-5-2-6-11-18/h1-6,8-11,19H,7,12-16H2 |
| InChIKey | WMYITKFCIAEKDJ-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.31 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|