C25H23Cl2NO4 — CID 59405966
(E)-3-[4-[2-[3,5-dichloro-2-[(3-ethylphenoxy)methyl]-6-oxo-1-pyridinyl]ethyl]phenyl]prop-2-enoic acid (PubChem CID 59405966) has the molecular formula C25H23Cl2NO4 and a molecular weight of 472.37 g/mol. Its IUPAC name is (E)-3-[4-[2-[3,5-dichloro-2-[(3-ethylphenoxy)methyl]-6-oxo-1-pyridinyl]ethyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[2-[3,5-dichloro-2-[(3-ethylphenoxy)methyl]-6-oxo-1-pyridinyl]ethyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 59405966 |
| Molecular Formula | C25H23Cl2NO4 |
| Molecular Weight | 472.37 g/mol |
| Exact Mass | 471.10 |
| IUPAC Name | (E)-3-[4-[2-[3,5-dichloro-2-[(3-ethylphenoxy)methyl]-6-oxo-1-pyridinyl]ethyl]phenyl]prop-2-enoic acid |
| SMILES | CCc1cccc(OCc2c(Cl)cc(Cl)c(=O)n2CCc2ccc(/C=C/C(=O)O)cc2)c1 |
| InChI | InChI=1S/C25H23Cl2NO4/c1-2-17-4-3-5-20(14-17)32-16-23-21(26)15-22(27)25(31)28(23)13-12-19-8-6-18(7-9-19)10-11-24(29)30/h3-11,14-15H,2,12-13,16H2,1H3,(H,29,30)/b11-10+ |
| InChIKey | WKHRBYGBDRELJF-ZHACJKMWSA-N |
| XLogP | 5.64 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.37 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|