C27H22Cl2N2O4 — CID 70916967
amino 4-[2-[3,5-dichloro-2-oxo-6-[(3-phenylphenoxy)methyl]-1-pyridinyl]ethyl]benzoate (PubChem CID 70916967) has the molecular formula C27H22Cl2N2O4 and a molecular weight of 509.39 g/mol. Its IUPAC name is amino 4-[2-[3,5-dichloro-2-oxo-6-[(3-phenylphenoxy)methyl]-1-pyridinyl]ethyl]benzoate.
| Compound Name | amino 4-[2-[3,5-dichloro-2-oxo-6-[(3-phenylphenoxy)methyl]-1-pyridinyl]ethyl]benzoate |
|---|---|
| PubChem CID | 70916967 |
| Molecular Formula | C27H22Cl2N2O4 |
| Molecular Weight | 509.39 g/mol |
| Exact Mass | 508.10 |
| IUPAC Name | amino 4-[2-[3,5-dichloro-2-oxo-6-[(3-phenylphenoxy)methyl]-1-pyridinyl]ethyl]benzoate |
| SMILES | NOC(=O)c1ccc(CCn2c(COc3cccc(-c4ccccc4)c3)c(Cl)cc(Cl)c2=O)cc1 |
| InChI | InChI=1S/C27H22Cl2N2O4/c28-23-16-24(29)26(32)31(14-13-18-9-11-20(12-10-18)27(33)35-30)25(23)17-34-22-8-4-7-21(15-22)19-5-2-1-3-6-19/h1-12,15-16H,13-14,17,30H2 |
| InChIKey | BSMMAGIGDWBETF-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.39 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|