About amino 4-[2-[3,5-dichloro-2-oxo-6-[(E)-2-phenylethenyl]-1-pyridinyl]ethyl]benzoate
amino 4-[2-[3,5-dichloro-2-oxo-6-[(E)-2-phenylethenyl]-1-pyridinyl]ethyl]benzoate (PubChem CID 89098734) has the molecular formula C22H18Cl2N2O3
and a molecular weight of 429.30 g/mol. Its IUPAC name is amino 4-[2-[3,5-dichloro-2-oxo-6-[(E)-2-phenylethenyl]-1-pyridinyl]ethyl]benzoate.
Molecular Properties
| Compound Name | amino 4-[2-[3,5-dichloro-2-oxo-6-[(E)-2-phenylethenyl]-1-pyridinyl]ethyl]benzoate |
| PubChem CID | 89098734 |
| Molecular Formula | C22H18Cl2N2O3 |
| Molecular Weight | 429.30 g/mol |
| Exact Mass | 428.07 |
| IUPAC Name | amino 4-[2-[3,5-dichloro-2-oxo-6-[(E)-2-phenylethenyl]-1-pyridinyl]ethyl]benzoate |
| SMILES | NOC(=O)c1ccc(CCn2c(/C=C/c3ccccc3)c(Cl)cc(Cl)c2=O)cc1 |
| InChI | InChI=1S/C22H18Cl2N2O3/c23-18-14-19(24)21(27)26(20(18)11-8-15-4-2-1-3-5-15)13-12-16-6-9-17(10-7-16)22(28)29-25/h1-11,14H,12-13,25H2/b11-8+ |
| InChIKey | DFTPKVKCQUYQSG-DHZHZOJOSA-N |
| XLogP | 4.60 |
| TPSA | 74.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 429.30 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze amino 4-[2-[3,5-dichloro-2-oxo-6-[(E)-2-phenylethenyl]-1-pyridinyl]ethyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of amino 4-[2-[3,5-dichloro-2-oxo-6-[(E)-2-phenylethenyl]-1-pyridinyl]ethyl]benzoate?
The IUPAC name of amino 4-[2-[3,5-dichloro-2-oxo-6-[(E)-2-phenylethenyl]-1-pyridinyl]ethyl]benzoate (CID 89098734) is amino 4-[2-[3,5-dichloro-2-oxo-6-[(E)-2-phenylethenyl]-1-pyridinyl]ethyl]benzoate.
What is the SMILES notation for amino 4-[2-[3,5-dichloro-2-oxo-6-[(E)-2-phenylethenyl]-1-pyridinyl]ethyl]benzoate?
The canonical SMILES for amino 4-[2-[3,5-dichloro-2-oxo-6-[(E)-2-phenylethenyl]-1-pyridinyl]ethyl]benzoate is NOC(=O)c1ccc(CCn2c(/C=C/c3ccccc3)c(Cl)cc(Cl)c2=O)cc1.
What is the InChIKey of amino 4-[2-[3,5-dichloro-2-oxo-6-[(E)-2-phenylethenyl]-1-pyridinyl]ethyl]benzoate?
The InChIKey is DFTPKVKCQUYQSG-DHZHZOJOSA-N. The full InChI is InChI=1S/C22H18Cl2N2O3/c23-18-14-19(24)21(27)26(20(18)11-8-15-4-2-1-3-5-15)13-12-16-6-9-17(10-7-16)22(28)29-25/h1-11,14H,12-13,25H2/b11-8+.
What are the key properties of amino 4-[2-[3,5-dichloro-2-oxo-6-[(E)-2-phenylethenyl]-1-pyridinyl]ethyl]benzoate?
amino 4-[2-[3,5-dichloro-2-oxo-6-[(E)-2-phenylethenyl]-1-pyridinyl]ethyl]benzoate has a molecular weight of 429.30 g/mol, XLogP of 4.60, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for amino 4-[2-[3,5-dichloro-2-oxo-6-[(E)-2-phenylethenyl]-1-pyridinyl]ethyl]benzoate is sourced from PubChem (CID 89098734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).