C22H18Cl2N2O3 — CID 89098734
amino 4-[2-[3,5-dichloro-2-oxo-6-[(E)-2-phenylethenyl]-1-pyridinyl]ethyl]benzoate (PubChem CID 89098734) has the molecular formula C22H18Cl2N2O3 and a molecular weight of 429.30 g/mol. Its IUPAC name is amino 4-[2-[3,5-dichloro-2-oxo-6-[(E)-2-phenylethenyl]-1-pyridinyl]ethyl]benzoate.
| Compound Name | amino 4-[2-[3,5-dichloro-2-oxo-6-[(E)-2-phenylethenyl]-1-pyridinyl]ethyl]benzoate |
|---|---|
| PubChem CID | 89098734 |
| Molecular Formula | C22H18Cl2N2O3 |
| Molecular Weight | 429.30 g/mol |
| Exact Mass | 428.07 |
| IUPAC Name | amino 4-[2-[3,5-dichloro-2-oxo-6-[(E)-2-phenylethenyl]-1-pyridinyl]ethyl]benzoate |
| SMILES | NOC(=O)c1ccc(CCn2c(/C=C/c3ccccc3)c(Cl)cc(Cl)c2=O)cc1 |
| InChI | InChI=1S/C22H18Cl2N2O3/c23-18-14-19(24)21(27)26(20(18)11-8-15-4-2-1-3-5-15)13-12-16-6-9-17(10-7-16)22(28)29-25/h1-11,14H,12-13,25H2/b11-8+ |
| InChIKey | DFTPKVKCQUYQSG-DHZHZOJOSA-N |
| XLogP | 4.60 |
| TPSA | 74.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.30 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|