C24H22Cl2N2O4 — CID 89098724
amino 4-[2-[3,5-dichloro-2-[(E)-2-(2-ethoxyphenyl)ethenyl]-6-oxo-1-pyridinyl]ethyl]benzoate (PubChem CID 89098724) has the molecular formula C24H22Cl2N2O4 and a molecular weight of 473.36 g/mol. Its IUPAC name is amino 4-[2-[3,5-dichloro-2-[(E)-2-(2-ethoxyphenyl)ethenyl]-6-oxo-1-pyridinyl]ethyl]benzoate.
| Compound Name | amino 4-[2-[3,5-dichloro-2-[(E)-2-(2-ethoxyphenyl)ethenyl]-6-oxo-1-pyridinyl]ethyl]benzoate |
|---|---|
| PubChem CID | 89098724 |
| Molecular Formula | C24H22Cl2N2O4 |
| Molecular Weight | 473.36 g/mol |
| Exact Mass | 472.10 |
| IUPAC Name | amino 4-[2-[3,5-dichloro-2-[(E)-2-(2-ethoxyphenyl)ethenyl]-6-oxo-1-pyridinyl]ethyl]benzoate |
| SMILES | CCOc1ccccc1/C=C/c1c(Cl)cc(Cl)c(=O)n1CCc1ccc(C(=O)ON)cc1 |
| InChI | InChI=1S/C24H22Cl2N2O4/c1-2-31-22-6-4-3-5-17(22)11-12-21-19(25)15-20(26)23(29)28(21)14-13-16-7-9-18(10-8-16)24(30)32-27/h3-12,15H,2,13-14,27H2,1H3/b12-11+ |
| InChIKey | RSNUOKTWLBGNLB-VAWYXSNFSA-N |
| XLogP | 5.00 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.36 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|