C23H22Cl2N2O5 — CID 70916972
amino 4-[2-[3,5-dichloro-2-[(2-ethoxyphenoxy)methyl]-6-oxo-1-pyridinyl]ethyl]benzoate (PubChem CID 70916972) has the molecular formula C23H22Cl2N2O5 and a molecular weight of 477.34 g/mol. Its IUPAC name is amino 4-[2-[3,5-dichloro-2-[(2-ethoxyphenoxy)methyl]-6-oxo-1-pyridinyl]ethyl]benzoate.
| Compound Name | amino 4-[2-[3,5-dichloro-2-[(2-ethoxyphenoxy)methyl]-6-oxo-1-pyridinyl]ethyl]benzoate |
|---|---|
| PubChem CID | 70916972 |
| Molecular Formula | C23H22Cl2N2O5 |
| Molecular Weight | 477.34 g/mol |
| Exact Mass | 476.09 |
| IUPAC Name | amino 4-[2-[3,5-dichloro-2-[(2-ethoxyphenoxy)methyl]-6-oxo-1-pyridinyl]ethyl]benzoate |
| SMILES | CCOc1ccccc1OCc1c(Cl)cc(Cl)c(=O)n1CCc1ccc(C(=O)ON)cc1 |
| InChI | InChI=1S/C23H22Cl2N2O5/c1-2-30-20-5-3-4-6-21(20)31-14-19-17(24)13-18(25)22(28)27(19)12-11-15-7-9-16(10-8-15)23(29)32-26/h3-10,13H,2,11-12,14,26H2,1H3 |
| InChIKey | RYAXUESIXSMFCD-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.34 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|