C23H23Cl2N3O3 — CID 59405877
4-[2-[3,5-dichloro-2-[(3-ethylphenoxy)methyl]-6-oxo-1-pyridinyl]ethyl]benzohydrazide (PubChem CID 59405877) has the molecular formula C23H23Cl2N3O3 and a molecular weight of 460.36 g/mol. Its IUPAC name is 4-[2-[3,5-dichloro-2-[(3-ethylphenoxy)methyl]-6-oxo-1-pyridinyl]ethyl]benzohydrazide.
| Compound Name | 4-[2-[3,5-dichloro-2-[(3-ethylphenoxy)methyl]-6-oxo-1-pyridinyl]ethyl]benzohydrazide |
|---|---|
| PubChem CID | 59405877 |
| Molecular Formula | C23H23Cl2N3O3 |
| Molecular Weight | 460.36 g/mol |
| Exact Mass | 459.11 |
| IUPAC Name | 4-[2-[3,5-dichloro-2-[(3-ethylphenoxy)methyl]-6-oxo-1-pyridinyl]ethyl]benzohydrazide |
| SMILES | CCc1cccc(OCc2c(Cl)cc(Cl)c(=O)n2CCc2ccc(C(=O)NN)cc2)c1 |
| InChI | InChI=1S/C23H23Cl2N3O3/c1-2-15-4-3-5-18(12-15)31-14-21-19(24)13-20(25)23(30)28(21)11-10-16-6-8-17(9-7-16)22(29)27-26/h3-9,12-13H,2,10-11,14,26H2,1H3,(H,27,29) |
| InChIKey | HUQZJKCMHPZZSW-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 86.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.36 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|