C29H32N2O4 — CID 70916978
amino 4-[2-[3,5-dicyclopropyl-2-[(3-ethylphenoxy)methyl]-6-oxo-1-pyridinyl]ethyl]benzoate (PubChem CID 70916978) has the molecular formula C29H32N2O4 and a molecular weight of 472.59 g/mol. Its IUPAC name is amino 4-[2-[3,5-dicyclopropyl-2-[(3-ethylphenoxy)methyl]-6-oxo-1-pyridinyl]ethyl]benzoate.
| Compound Name | amino 4-[2-[3,5-dicyclopropyl-2-[(3-ethylphenoxy)methyl]-6-oxo-1-pyridinyl]ethyl]benzoate |
|---|---|
| PubChem CID | 70916978 |
| Molecular Formula | C29H32N2O4 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.24 |
| IUPAC Name | amino 4-[2-[3,5-dicyclopropyl-2-[(3-ethylphenoxy)methyl]-6-oxo-1-pyridinyl]ethyl]benzoate |
| SMILES | CCc1cccc(OCc2c(C3CC3)cc(C3CC3)c(=O)n2CCc2ccc(C(=O)ON)cc2)c1 |
| InChI | InChI=1S/C29H32N2O4/c1-2-19-4-3-5-24(16-19)34-18-27-25(21-10-11-21)17-26(22-12-13-22)28(32)31(27)15-14-20-6-8-23(9-7-20)29(33)35-30/h3-9,16-17,21-22H,2,10-15,18,30H2,1H3 |
| InChIKey | CTSHRLDGWGFALI-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|