C20H17FN2O3S — CID 59406527
6-(2-fluorophenyl)-N-[(4-methylsulfonylphenyl)methyl]pyridine-2-carboxamide (PubChem CID 59406527) has the molecular formula C20H17FN2O3S and a molecular weight of 384.43 g/mol. Its IUPAC name is 6-(2-fluorophenyl)-N-[(4-methylsulfonylphenyl)methyl]pyridine-2-carboxamide.
| Compound Name | 6-(2-fluorophenyl)-N-[(4-methylsulfonylphenyl)methyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 59406527 |
| Molecular Formula | C20H17FN2O3S |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | 6-(2-fluorophenyl)-N-[(4-methylsulfonylphenyl)methyl]pyridine-2-carboxamide |
| SMILES | CS(=O)(=O)c1ccc(CNC(=O)c2cccc(-c3ccccc3F)n2)cc1 |
| InChI | InChI=1S/C20H17FN2O3S/c1-27(25,26)15-11-9-14(10-12-15)13-22-20(24)19-8-4-7-18(23-19)16-5-2-3-6-17(16)21/h2-12H,13H2,1H3,(H,22,24) |
| InChIKey | SNWJUXYGAAOAAO-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |