C17H15BrN4O3S — CID 59406543
6-(4-bromoimidazol-1-yl)-N-[(4-methylsulfonylphenyl)methyl]pyridine-2-carboxamide (PubChem CID 59406543) has the molecular formula C17H15BrN4O3S and a molecular weight of 435.30 g/mol. Its IUPAC name is 6-(4-bromoimidazol-1-yl)-N-[(4-methylsulfonylphenyl)methyl]pyridine-2-carboxamide.
| Compound Name | 6-(4-bromoimidazol-1-yl)-N-[(4-methylsulfonylphenyl)methyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 59406543 |
| Molecular Formula | C17H15BrN4O3S |
| Molecular Weight | 435.30 g/mol |
| Exact Mass | 434.00 |
| IUPAC Name | 6-(4-bromoimidazol-1-yl)-N-[(4-methylsulfonylphenyl)methyl]pyridine-2-carboxamide |
| SMILES | CS(=O)(=O)c1ccc(CNC(=O)c2cccc(-n3cnc(Br)c3)n2)cc1 |
| InChI | InChI=1S/C17H15BrN4O3S/c1-26(24,25)13-7-5-12(6-8-13)9-19-17(23)14-3-2-4-16(21-14)22-10-15(18)20-11-22/h2-8,10-11H,9H2,1H3,(H,19,23) |
| InChIKey | ZXELBORPMBVIQZ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.30 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |