C27H19N5O — CID 59412127
2-(1-benzofuran-2-yl)-3-[3-(2H-tetrazol-5-yl)phenyl]-4,5-dihydrobenzo[e]indole (PubChem CID 59412127) has the molecular formula C27H19N5O and a molecular weight of 429.48 g/mol. Its IUPAC name is 2-(1-benzofuran-2-yl)-3-[3-(2H-tetrazol-5-yl)phenyl]-4,5-dihydrobenzo[e]indole.
| Compound Name | 2-(1-benzofuran-2-yl)-3-[3-(2H-tetrazol-5-yl)phenyl]-4,5-dihydrobenzo[e]indole |
|---|---|
| PubChem CID | 59412127 |
| Molecular Formula | C27H19N5O |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | 2-(1-benzofuran-2-yl)-3-[3-(2H-tetrazol-5-yl)phenyl]-4,5-dihydrobenzo[e]indole |
| SMILES | c1cc(-c2nn[nH]n2)cc(-n2c(-c3cc4ccccc4o3)cc3c2CCc2ccccc2-3)c1 |
| InChI | InChI=1S/C27H19N5O/c1-3-10-21-17(6-1)12-13-23-22(21)16-24(26-15-18-7-2-4-11-25(18)33-26)32(23)20-9-5-8-19(14-20)27-28-30-31-29-27/h1-11,14-16H,12-13H2,(H,28,29,30,31) |
| InChIKey | SDYVNZSTGGCISL-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 72.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|