C30H23N5O2 — CID 70905441
2-(1,3-benzodioxol-5-yl)-1-[3-(2H-tetrazol-5-yl)phenyl]-6,7,8,9-tetrahydronaphtho[2,1-e]indole (PubChem CID 70905441) has the molecular formula C30H23N5O2 and a molecular weight of 485.55 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-1-[3-(2H-tetrazol-5-yl)phenyl]-6,7,8,9-tetrahydronaphtho[2,1-e]indole.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-1-[3-(2H-tetrazol-5-yl)phenyl]-6,7,8,9-tetrahydronaphtho[2,1-e]indole |
|---|---|
| PubChem CID | 70905441 |
| Molecular Formula | C30H23N5O2 |
| Molecular Weight | 485.55 g/mol |
| Exact Mass | 485.19 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-1-[3-(2H-tetrazol-5-yl)phenyl]-6,7,8,9-tetrahydronaphtho[2,1-e]indole |
| SMILES | c1cc(-c2nn[nH]n2)cc(-n2c(-c3ccc4c(c3)OCO4)cc3c4ccc5c(c4ccc32)CCCC5)c1 |
| InChI | InChI=1S/C30H23N5O2/c1-2-7-22-18(4-1)8-10-24-23(22)11-12-26-25(24)16-27(19-9-13-28-29(15-19)37-17-36-28)35(26)21-6-3-5-20(14-21)30-31-33-34-32-30/h3,5-6,8-16H,1-2,4,7,17H2,(H,31,32,33,34) |
| InChIKey | UOVZCFPRUQDWPB-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 77.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.55 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |