C23H32N3OSY- — CID 59414031
(2S)-N-ethyl-4-methyl-2-[[4-(4-piperidin-1-ylphenyl)thiophen-3-yl]amino]pentanamide;yttrium (PubChem CID 59414031) has the molecular formula C23H32N3OSY- and a molecular weight of 487.50 g/mol. Its IUPAC name is (2S)-N-ethyl-4-methyl-2-[[4-(4-piperidin-1-ylphenyl)thiophen-3-yl]amino]pentanamide;yttrium.
| Compound Name | (2S)-N-ethyl-4-methyl-2-[[4-(4-piperidin-1-ylphenyl)thiophen-3-yl]amino]pentanamide;yttrium |
|---|---|
| PubChem CID | 59414031 |
| Molecular Formula | C23H32N3OSY- |
| Molecular Weight | 487.50 g/mol |
| Exact Mass | 487.13 |
| IUPAC Name | (2S)-N-ethyl-4-methyl-2-[[4-(4-piperidin-1-ylphenyl)thiophen-3-yl]amino]pentanamide;yttrium |
| SMILES | C[CH-]NC(=O)[C@H](CC(C)C)Nc1cscc1-c1ccc(N2CCCCC2)cc1.[Y] |
| InChI | InChI=1S/C23H32N3OS.Y/c1-4-24-23(27)21(14-17(2)3)25-22-16-28-15-20(22)18-8-10-19(11-9-18)26-12-6-5-7-13-26;/h4,8-11,15-17,21,25H,5-7,12-14H2,1-3H3,(H,24,27);/q-1;/t21-;/m0./s1 |
| InChIKey | RQYCKINBDVDFCZ-BOXHHOBZSA-N |
| XLogP | 5.53 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.50 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|