C30H28F3N2NaO8S — CID 59414676
sodium 2-methyl-5-[[4-[4-(6-prop-2-enoyloxyhexoxy)benzoyl]oxy-3-(trifluoromethyl)phenyl]diazenyl]benzenesulfonate (PubChem CID 59414676) has the molecular formula C30H28F3N2NaO8S and a molecular weight of 656.61 g/mol. Its IUPAC name is sodium 2-methyl-5-[[4-[4-(6-prop-2-enoyloxyhexoxy)benzoyl]oxy-3-(trifluoromethyl)phenyl]diazenyl]benzenesulfonate.
| Compound Name | sodium 2-methyl-5-[[4-[4-(6-prop-2-enoyloxyhexoxy)benzoyl]oxy-3-(trifluoromethyl)phenyl]diazenyl]benzenesulfonate |
|---|---|
| PubChem CID | 59414676 |
| Molecular Formula | C30H28F3N2NaO8S |
| Molecular Weight | 656.61 g/mol |
| Exact Mass | 656.14 |
| IUPAC Name | sodium 2-methyl-5-[[4-[4-(6-prop-2-enoyloxyhexoxy)benzoyl]oxy-3-(trifluoromethyl)phenyl]diazenyl]benzenesulfonate |
| SMILES | C=CC(=O)OCCCCCCOc1ccc(C(=O)Oc2ccc(/N=N/c3ccc(C)c(S(=O)(=O)[O-])c3)cc2C(F)(F)F)cc1.[Na+] |
| InChI | InChI=1S/C30H29F3N2O8S.Na/c1-3-28(36)42-17-7-5-4-6-16-41-24-13-9-21(10-14-24)29(37)43-26-15-12-22(18-25(26)30(31,32)33)34-35-23-11-8-20(2)27(19-23)44(38,39)40;/h3,8-15,18-19H,1,4-7,16-17H2,2H3,(H,38,39,40);/q;+1/p-1/b35-34+; |
| InChIKey | GYSSLBFDYHITKP-LOSWNTLOSA-M |
| XLogP | 4.22 |
| TPSA | 143.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.61 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|