C25H25N5O — CID 59416635
1-[4-[3-methyl-2-[4-(2H-tetrazol-5-yl)phenyl]butan-2-yl]phenyl]-2-pyridin-2-ylethanone (PubChem CID 59416635) has the molecular formula C25H25N5O and a molecular weight of 411.51 g/mol. Its IUPAC name is 1-[4-[3-methyl-2-[4-(2H-tetrazol-5-yl)phenyl]butan-2-yl]phenyl]-2-pyridin-2-ylethanone.
| Compound Name | 1-[4-[3-methyl-2-[4-(2H-tetrazol-5-yl)phenyl]butan-2-yl]phenyl]-2-pyridin-2-ylethanone |
|---|---|
| PubChem CID | 59416635 |
| Molecular Formula | C25H25N5O |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.21 |
| IUPAC Name | 1-[4-[3-methyl-2-[4-(2H-tetrazol-5-yl)phenyl]butan-2-yl]phenyl]-2-pyridin-2-ylethanone |
| SMILES | CC(C)C(C)(c1ccc(C(=O)Cc2ccccn2)cc1)c1ccc(-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C25H25N5O/c1-17(2)25(3,21-13-9-19(10-14-21)24-27-29-30-28-24)20-11-7-18(8-12-20)23(31)16-22-6-4-5-15-26-22/h4-15,17H,16H2,1-3H3,(H,27,28,29,30) |
| InChIKey | FJOFTYIFZDUNKI-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |