C12H12Cl2N2O — CID 59419452
1-[(3,5-dichloro-4-isocyanatophenyl)methyl]pyrrolidine (PubChem CID 59419452) has the molecular formula C12H12Cl2N2O and a molecular weight of 271.15 g/mol. Its IUPAC name is 1-[(3,5-dichloro-4-isocyanatophenyl)methyl]pyrrolidine.
| Compound Name | 1-[(3,5-dichloro-4-isocyanatophenyl)methyl]pyrrolidine |
|---|---|
| PubChem CID | 59419452 |
| Molecular Formula | C12H12Cl2N2O |
| Molecular Weight | 271.15 g/mol |
| Exact Mass | 270.03 |
| IUPAC Name | 1-[(3,5-dichloro-4-isocyanatophenyl)methyl]pyrrolidine |
| SMILES | O=C=Nc1c(Cl)cc(CN2CCCC2)cc1Cl |
| InChI | InChI=1S/C12H12Cl2N2O/c13-10-5-9(7-16-3-1-2-4-16)6-11(14)12(10)15-8-17/h5-6H,1-4,7H2 |
| InChIKey | WPDWQLIEIBDTPC-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.15 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|