C27H33ClN4O4 — CID 59421546
ethyl 6-chloro-1-[3-[hydroxy-(2-morpholin-4-ylethylamino)methyl]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate (PubChem CID 59421546) has the molecular formula C27H33ClN4O4 and a molecular weight of 513.04 g/mol. Its IUPAC name is ethyl 6-chloro-1-[3-[hydroxy-(2-morpholin-4-ylethylamino)methyl]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate.
| Compound Name | ethyl 6-chloro-1-[3-[hydroxy-(2-morpholin-4-ylethylamino)methyl]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
|---|---|
| PubChem CID | 59421546 |
| Molecular Formula | C27H33ClN4O4 |
| Molecular Weight | 513.04 g/mol |
| Exact Mass | 512.22 |
| IUPAC Name | ethyl 6-chloro-1-[3-[hydroxy-(2-morpholin-4-ylethylamino)methyl]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
| SMILES | CCOC(=O)N1CCc2c([nH]c3ccc(Cl)cc23)C1c1cccc(C(O)NCCN2CCOCC2)c1 |
| InChI | InChI=1S/C27H33ClN4O4/c1-2-36-27(34)32-10-8-21-22-17-20(28)6-7-23(22)30-24(21)25(32)18-4-3-5-19(16-18)26(33)29-9-11-31-12-14-35-15-13-31/h3-7,16-17,25-26,29-30,33H,2,8-15H2,1H3 |
| InChIKey | MVKTXGPJKIWEMT-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.04 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|