C25H29ClN4O4 — CID 143111264
ethyl 6-chloro-1-[3-[2-(2-hydroxyethylamino)ethylcarbamoyl]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate (PubChem CID 143111264) has the molecular formula C25H29ClN4O4 and a molecular weight of 484.98 g/mol. Its IUPAC name is ethyl 6-chloro-1-[3-[2-(2-hydroxyethylamino)ethylcarbamoyl]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate.
| Compound Name | ethyl 6-chloro-1-[3-[2-(2-hydroxyethylamino)ethylcarbamoyl]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
|---|---|
| PubChem CID | 143111264 |
| Molecular Formula | C25H29ClN4O4 |
| Molecular Weight | 484.98 g/mol |
| Exact Mass | 484.19 |
| IUPAC Name | ethyl 6-chloro-1-[3-[2-(2-hydroxyethylamino)ethylcarbamoyl]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
| SMILES | CCOC(=O)N1CCc2c([nH]c3ccc(Cl)cc23)C1c1cccc(C(=O)NCCNCCO)c1 |
| InChI | InChI=1S/C25H29ClN4O4/c1-2-34-25(33)30-12-8-19-20-15-18(26)6-7-21(20)29-22(19)23(30)16-4-3-5-17(14-16)24(32)28-10-9-27-11-13-31/h3-7,14-15,23,27,29,31H,2,8-13H2,1H3,(H,28,32) |
| InChIKey | DFTROXDHVHOEHC-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 106.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.98 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|