C24H28ClN3O4 — CID 66791894
ethyl 6-chloro-1-[3-(2-methoxyethylcarbamoyl)phenyl]-1,3,4,6,7,9-hexahydropyrido[3,4-b]indole-2-carboxylate (PubChem CID 66791894) has the molecular formula C24H28ClN3O4 and a molecular weight of 457.96 g/mol. Its IUPAC name is ethyl 6-chloro-1-[3-(2-methoxyethylcarbamoyl)phenyl]-1,3,4,6,7,9-hexahydropyrido[3,4-b]indole-2-carboxylate.
| Compound Name | ethyl 6-chloro-1-[3-(2-methoxyethylcarbamoyl)phenyl]-1,3,4,6,7,9-hexahydropyrido[3,4-b]indole-2-carboxylate |
|---|---|
| PubChem CID | 66791894 |
| Molecular Formula | C24H28ClN3O4 |
| Molecular Weight | 457.96 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | ethyl 6-chloro-1-[3-(2-methoxyethylcarbamoyl)phenyl]-1,3,4,6,7,9-hexahydropyrido[3,4-b]indole-2-carboxylate |
| SMILES | CCOC(=O)N1CCc2c([nH]c3c2=CC(Cl)CC=3)C1c1cccc(C(=O)NCCOC)c1 |
| InChI | InChI=1S/C24H28ClN3O4/c1-3-32-24(30)28-11-9-18-19-14-17(25)7-8-20(19)27-21(18)22(28)15-5-4-6-16(13-15)23(29)26-10-12-31-2/h4-6,8,13-14,17,22,27H,3,7,9-12H2,1-2H3,(H,26,29) |
| InChIKey | MWSUMSPTKQZEOT-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 83.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.96 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|