C26H25ClN2O5S — CID 88993873
(4-methoxyphenyl) 6-chloro-1-(4-methylsulfonylphenyl)-1,3,4,6,7,9-hexahydropyrido[3,4-b]indole-2-carboxylate (PubChem CID 88993873) has the molecular formula C26H25ClN2O5S and a molecular weight of 513.02 g/mol. Its IUPAC name is (4-methoxyphenyl) 6-chloro-1-(4-methylsulfonylphenyl)-1,3,4,6,7,9-hexahydropyrido[3,4-b]indole-2-carboxylate.
| Compound Name | (4-methoxyphenyl) 6-chloro-1-(4-methylsulfonylphenyl)-1,3,4,6,7,9-hexahydropyrido[3,4-b]indole-2-carboxylate |
|---|---|
| PubChem CID | 88993873 |
| Molecular Formula | C26H25ClN2O5S |
| Molecular Weight | 513.02 g/mol |
| Exact Mass | 512.12 |
| IUPAC Name | (4-methoxyphenyl) 6-chloro-1-(4-methylsulfonylphenyl)-1,3,4,6,7,9-hexahydropyrido[3,4-b]indole-2-carboxylate |
| SMILES | COc1ccc(OC(=O)N2CCc3c([nH]c4c3=CC(Cl)CC=4)C2c2ccc(S(C)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C26H25ClN2O5S/c1-33-18-6-8-19(9-7-18)34-26(30)29-14-13-21-22-15-17(27)5-12-23(22)28-24(21)25(29)16-3-10-20(11-4-16)35(2,31)32/h3-4,6-12,15,17,25,28H,5,13-14H2,1-2H3 |
| InChIKey | QPZFOIGIYGTJBT-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 88.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.02 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|