C28H29ClN2O4 — CID 88995039
(4-methylphenyl) (1S)-6-chloro-1-[4-(3-hydroxypropoxy)phenyl]-1,3,4,6,7,9-hexahydropyrido[3,4-b]indole-2-carboxylate (PubChem CID 88995039) has the molecular formula C28H29ClN2O4 and a molecular weight of 493.00 g/mol. Its IUPAC name is (4-methylphenyl) (1S)-6-chloro-1-[4-(3-hydroxypropoxy)phenyl]-1,3,4,6,7,9-hexahydropyrido[3,4-b]indole-2-carboxylate.
| Compound Name | (4-methylphenyl) (1S)-6-chloro-1-[4-(3-hydroxypropoxy)phenyl]-1,3,4,6,7,9-hexahydropyrido[3,4-b]indole-2-carboxylate |
|---|---|
| PubChem CID | 88995039 |
| Molecular Formula | C28H29ClN2O4 |
| Molecular Weight | 493.00 g/mol |
| Exact Mass | 492.18 |
| IUPAC Name | (4-methylphenyl) (1S)-6-chloro-1-[4-(3-hydroxypropoxy)phenyl]-1,3,4,6,7,9-hexahydropyrido[3,4-b]indole-2-carboxylate |
| SMILES | Cc1ccc(OC(=O)N2CCc3c([nH]c4c3=CC(Cl)CC=4)[C@@H]2c2ccc(OCCCO)cc2)cc1 |
| InChI | InChI=1S/C28H29ClN2O4/c1-18-3-8-22(9-4-18)35-28(33)31-14-13-23-24-17-20(29)7-12-25(24)30-26(23)27(31)19-5-10-21(11-6-19)34-16-2-15-32/h3-6,8-12,17,20,27,30,32H,2,7,13-16H2,1H3/t20?,27-/m0/s1 |
| InChIKey | UBDCIHXMFUORSS-OHMHCFLMSA-N |
| XLogP | 3.80 |
| TPSA | 74.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.00 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|