C31H32ClN3O6 — CID 88994949
(4-methoxyphenyl) 6-chloro-1-[4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]-1,3,4,6,7,9-hexahydropyrido[3,4-b]indole-2-carboxylate (PubChem CID 88994949) has the molecular formula C31H32ClN3O6 and a molecular weight of 578.07 g/mol. Its IUPAC name is (4-methoxyphenyl) 6-chloro-1-[4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]-1,3,4,6,7,9-hexahydropyrido[3,4-b]indole-2-carboxylate.
| Compound Name | (4-methoxyphenyl) 6-chloro-1-[4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]-1,3,4,6,7,9-hexahydropyrido[3,4-b]indole-2-carboxylate |
|---|---|
| PubChem CID | 88994949 |
| Molecular Formula | C31H32ClN3O6 |
| Molecular Weight | 578.07 g/mol |
| Exact Mass | 577.20 |
| IUPAC Name | (4-methoxyphenyl) 6-chloro-1-[4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]-1,3,4,6,7,9-hexahydropyrido[3,4-b]indole-2-carboxylate |
| SMILES | COc1ccc(OC(=O)N2CCc3c([nH]c4c3=CC(Cl)CC=4)C2c2ccc(OCC(=O)N3CCOCC3)cc2)cc1 |
| InChI | InChI=1S/C31H32ClN3O6/c1-38-22-7-9-24(10-8-22)41-31(37)35-13-12-25-26-18-21(32)4-11-27(26)33-29(25)30(35)20-2-5-23(6-3-20)40-19-28(36)34-14-16-39-17-15-34/h2-3,5-11,18,21,30,33H,4,12-17,19H2,1H3 |
| InChIKey | KSWIAJPRTRKNRA-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 93.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.07 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|