C7H2ClLiN2O2S — CID 59424471
lithium 4-chlorothieno[3,2-d]pyrimidine-6-carboxylate (PubChem CID 59424471) has the molecular formula C7H2ClLiN2O2S and a molecular weight of 220.57 g/mol. Its IUPAC name is lithium 4-chlorothieno[3,2-d]pyrimidine-6-carboxylate.
| Compound Name | lithium 4-chlorothieno[3,2-d]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 59424471 |
| Molecular Formula | C7H2ClLiN2O2S |
| Molecular Weight | 220.57 g/mol |
| Exact Mass | 219.97 |
| IUPAC Name | lithium 4-chlorothieno[3,2-d]pyrimidine-6-carboxylate |
| SMILES | O=C([O-])c1cc2ncnc(Cl)c2s1.[Li+] |
| InChI | InChI=1S/C7H3ClN2O2S.Li/c8-6-5-3(9-2-10-6)1-4(13-5)7(11)12;/h1-2H,(H,11,12);/q;+1/p-1 |
| InChIKey | UYPMIDWZPQFLKE-UHFFFAOYSA-M |
| XLogP | -2.29 |
| TPSA | 65.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.57 |
| LogP ≤ 5 | -2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |