C6H7O4- — CID 59429212
3,7-dioxabicyclo[4.1.0]heptane-4-carboxylate (PubChem CID 59429212) has the molecular formula C6H7O4- and a molecular weight of 143.12 g/mol. Its IUPAC name is 3,7-dioxabicyclo[4.1.0]heptane-4-carboxylate.
| Compound Name | 3,7-dioxabicyclo[4.1.0]heptane-4-carboxylate |
|---|---|
| PubChem CID | 59429212 |
| Molecular Formula | C6H7O4- |
| Molecular Weight | 143.12 g/mol |
| Exact Mass | 143.03 |
| IUPAC Name | 3,7-dioxabicyclo[4.1.0]heptane-4-carboxylate |
| SMILES | O=C([O-])C1CC2OC2CO1 |
| InChI | InChI=1S/C6H8O4/c7-6(8)4-1-3-5(10-3)2-9-4/h3-5H,1-2H2,(H,7,8)/p-1 |
| InChIKey | MJYWTFNMEPVEFR-UHFFFAOYSA-M |
| XLogP | -1.71 |
| TPSA | 61.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.12 |
| LogP ≤ 5 | -1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|