C7H9O5- — CID 59429214
5-methoxy-3,7-dioxabicyclo[4.1.0]heptane-4-carboxylate (PubChem CID 59429214) has the molecular formula C7H9O5- and a molecular weight of 173.14 g/mol. Its IUPAC name is 5-methoxy-3,7-dioxabicyclo[4.1.0]heptane-4-carboxylate.
| Compound Name | 5-methoxy-3,7-dioxabicyclo[4.1.0]heptane-4-carboxylate |
|---|---|
| PubChem CID | 59429214 |
| Molecular Formula | C7H9O5- |
| Molecular Weight | 173.14 g/mol |
| Exact Mass | 173.05 |
| IUPAC Name | 5-methoxy-3,7-dioxabicyclo[4.1.0]heptane-4-carboxylate |
| SMILES | COC1C(C(=O)[O-])OCC2OC21 |
| InChI | InChI=1S/C7H10O5/c1-10-5-4-3(12-4)2-11-6(5)7(8)9/h3-6H,2H2,1H3,(H,8,9)/p-1 |
| InChIKey | SRBAMNKFKSKFPH-UHFFFAOYSA-M |
| XLogP | -2.08 |
| TPSA | 71.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.14 |
| LogP ≤ 5 | -2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|