C19H16N4O2S — CID 59429793
4-[[4-[4-(4-methylpyrazol-1-yl)phenyl]-1,3-thiazol-2-yl]amino]benzene-1,2-diol (PubChem CID 59429793) has the molecular formula C19H16N4O2S and a molecular weight of 364.43 g/mol. Its IUPAC name is 4-[[4-[4-(4-methylpyrazol-1-yl)phenyl]-1,3-thiazol-2-yl]amino]benzene-1,2-diol.
| Compound Name | 4-[[4-[4-(4-methylpyrazol-1-yl)phenyl]-1,3-thiazol-2-yl]amino]benzene-1,2-diol |
|---|---|
| PubChem CID | 59429793 |
| Molecular Formula | C19H16N4O2S |
| Molecular Weight | 364.43 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | 4-[[4-[4-(4-methylpyrazol-1-yl)phenyl]-1,3-thiazol-2-yl]amino]benzene-1,2-diol |
| SMILES | Cc1cnn(-c2ccc(-c3csc(Nc4ccc(O)c(O)c4)n3)cc2)c1 |
| InChI | InChI=1S/C19H16N4O2S/c1-12-9-20-23(10-12)15-5-2-13(3-6-15)16-11-26-19(22-16)21-14-4-7-17(24)18(25)8-14/h2-11,24-25H,1H3,(H,21,22) |
| InChIKey | FFLXKWRKIANIPU-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 83.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.43 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|