C22H27N3O5 — CID 59430339
4-(4-butoxyphenyl)-5-(2,3,4,5-tetramethoxyphenyl)-2H-triazole (PubChem CID 59430339) has the molecular formula C22H27N3O5 and a molecular weight of 413.47 g/mol. Its IUPAC name is 4-(4-butoxyphenyl)-5-(2,3,4,5-tetramethoxyphenyl)-2H-triazole.
| Compound Name | 4-(4-butoxyphenyl)-5-(2,3,4,5-tetramethoxyphenyl)-2H-triazole |
|---|---|
| PubChem CID | 59430339 |
| Molecular Formula | C22H27N3O5 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | 4-(4-butoxyphenyl)-5-(2,3,4,5-tetramethoxyphenyl)-2H-triazole |
| SMILES | CCCCOc1ccc(-c2n[nH]nc2-c2cc(OC)c(OC)c(OC)c2OC)cc1 |
| InChI | InChI=1S/C22H27N3O5/c1-6-7-12-30-15-10-8-14(9-11-15)18-19(24-25-23-18)16-13-17(26-2)21(28-4)22(29-5)20(16)27-3/h8-11,13H,6-7,12H2,1-5H3,(H,23,24,25) |
| InChIKey | ITYARBNCLGQAOL-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 87.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|