C20H27FO2 — CID 59440681
tert-butyl 3-fluoro-2-methyl-4-(1-methyl-3,4-dihydro-2H-naphthalen-1-yl)but-2-enoate (PubChem CID 59440681) has the molecular formula C20H27FO2 and a molecular weight of 318.43 g/mol. Its IUPAC name is tert-butyl 3-fluoro-2-methyl-4-(1-methyl-3,4-dihydro-2H-naphthalen-1-yl)but-2-enoate.
| Compound Name | tert-butyl 3-fluoro-2-methyl-4-(1-methyl-3,4-dihydro-2H-naphthalen-1-yl)but-2-enoate |
|---|---|
| PubChem CID | 59440681 |
| Molecular Formula | C20H27FO2 |
| Molecular Weight | 318.43 g/mol |
| Exact Mass | 318.20 |
| IUPAC Name | tert-butyl 3-fluoro-2-methyl-4-(1-methyl-3,4-dihydro-2H-naphthalen-1-yl)but-2-enoate |
| SMILES | CC(C(=O)OC(C)(C)C)=C(F)CC1(C)CCCc2ccccc21 |
| InChI | InChI=1S/C20H27FO2/c1-14(18(22)23-19(2,3)4)17(21)13-20(5)12-8-10-15-9-6-7-11-16(15)20/h6-7,9,11H,8,10,12-13H2,1-5H3 |
| InChIKey | APBALSHBQHKATC-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.43 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|