About 1-[5-(3,4-dichlorophenyl)-1H-pyrazol-3-yl]-N-(2-pyrrolidin-1-ylethyl)piperidin-4-amine
1-[5-(3,4-dichlorophenyl)-1H-pyrazol-3-yl]-N-(2-pyrrolidin-1-ylethyl)piperidin-4-amine (PubChem CID 59442849) has the molecular formula C20H27Cl2N5
and a molecular weight of 408.38 g/mol. Its IUPAC name is 1-[5-(3,4-dichlorophenyl)-1H-pyrazol-3-yl]-N-(2-pyrrolidin-1-ylethyl)piperidin-4-amine.
Molecular Properties
| Compound Name | 1-[5-(3,4-dichlorophenyl)-1H-pyrazol-3-yl]-N-(2-pyrrolidin-1-ylethyl)piperidin-4-amine |
| PubChem CID | 59442849 |
| Molecular Formula | C20H27Cl2N5 |
| Molecular Weight | 408.38 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | 1-[5-(3,4-dichlorophenyl)-1H-pyrazol-3-yl]-N-(2-pyrrolidin-1-ylethyl)piperidin-4-amine |
| SMILES | Clc1ccc(-c2cc(N3CCC(NCCN4CCCC4)CC3)n[nH]2)cc1Cl |
| InChI | InChI=1S/C20H27Cl2N5/c21-17-4-3-15(13-18(17)22)19-14-20(25-24-19)27-10-5-16(6-11-27)23-7-12-26-8-1-2-9-26/h3-4,13-14,16,23H,1-2,5-12H2,(H,24,25) |
| InChIKey | ISMPZXWCXYGBLP-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 47.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.38 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[5-(3,4-dichlorophenyl)-1H-pyrazol-3-yl]-N-(2-pyrrolidin-1-ylethyl)piperidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-(3,4-dichlorophenyl)-1H-pyrazol-3-yl]-N-(2-pyrrolidin-1-ylethyl)piperidin-4-amine?
The IUPAC name of 1-[5-(3,4-dichlorophenyl)-1H-pyrazol-3-yl]-N-(2-pyrrolidin-1-ylethyl)piperidin-4-amine (CID 59442849) is 1-[5-(3,4-dichlorophenyl)-1H-pyrazol-3-yl]-N-(2-pyrrolidin-1-ylethyl)piperidin-4-amine.
What is the SMILES notation for 1-[5-(3,4-dichlorophenyl)-1H-pyrazol-3-yl]-N-(2-pyrrolidin-1-ylethyl)piperidin-4-amine?
The canonical SMILES for 1-[5-(3,4-dichlorophenyl)-1H-pyrazol-3-yl]-N-(2-pyrrolidin-1-ylethyl)piperidin-4-amine is Clc1ccc(-c2cc(N3CCC(NCCN4CCCC4)CC3)n[nH]2)cc1Cl.
What is the InChIKey of 1-[5-(3,4-dichlorophenyl)-1H-pyrazol-3-yl]-N-(2-pyrrolidin-1-ylethyl)piperidin-4-amine?
The InChIKey is ISMPZXWCXYGBLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H27Cl2N5/c21-17-4-3-15(13-18(17)22)19-14-20(25-24-19)27-10-5-16(6-11-27)23-7-12-26-8-1-2-9-26/h3-4,13-14,16,23H,1-2,5-12H2,(H,24,25).
What are the key properties of 1-[5-(3,4-dichlorophenyl)-1H-pyrazol-3-yl]-N-(2-pyrrolidin-1-ylethyl)piperidin-4-amine?
1-[5-(3,4-dichlorophenyl)-1H-pyrazol-3-yl]-N-(2-pyrrolidin-1-ylethyl)piperidin-4-amine has a molecular weight of 408.38 g/mol, XLogP of 4.04, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-(3,4-dichlorophenyl)-1H-pyrazol-3-yl]-N-(2-pyrrolidin-1-ylethyl)piperidin-4-amine is sourced from PubChem (CID 59442849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).